C35H56O10 — CID 78155990
6-[6-(1,2-dihydroxy-2-methylpropyl)-4-methyl-2-oxooxan-3-yl]-6,7,12,12-tetramethyl-13-(3,4,5-trihydroxyoxan-2-yl)oxytetracyclo[9.4.0.01,3.03,8]pentadecane-7-carbaldehyde (PubChem CID 78155990) has the molecular formula C35H56O10 and a molecular weight of 636.82 g/mol. Its IUPAC name is 6-[6-(1,2-dihydroxy-2-methylpropyl)-4-methyl-2-oxooxan-3-yl]-6,7,12,12-tetramethyl-13-(3,4,5-trihydroxyoxan-2-yl)oxytetracyclo[9.4.0.01,3.03,8]pentadecane-7-carbaldehyde.
| Compound Name | 6-[6-(1,2-dihydroxy-2-methylpropyl)-4-methyl-2-oxooxan-3-yl]-6,7,12,12-tetramethyl-13-(3,4,5-trihydroxyoxan-2-yl)oxytetracyclo[9.4.0.01,3.03,8]pentadecane-7-carbaldehyde |
|---|---|
| PubChem CID | 78155990 |
| Molecular Formula | C35H56O10 |
| Molecular Weight | 636.82 g/mol |
| Exact Mass | 636.39 |
| IUPAC Name | 6-[6-(1,2-dihydroxy-2-methylpropyl)-4-methyl-2-oxooxan-3-yl]-6,7,12,12-tetramethyl-13-(3,4,5-trihydroxyoxan-2-yl)oxytetracyclo[9.4.0.01,3.03,8]pentadecane-7-carbaldehyde |
| SMILES | CC1CC(C(O)C(C)(C)O)OC(=O)C1C1(C)CCC23CC24CCC(OC2OCC(O)C(O)C2O)C(C)(C)C4CCC3C1(C)C=O |
| InChI | InChI=1S/C35H56O10/c1-18-14-20(27(40)31(4,5)42)44-28(41)24(18)32(6)12-13-35-16-34(35)11-10-23(45-29-26(39)25(38)19(37)15-43-29)30(2,3)21(34)8-9-22(35)33(32,7)17-36/h17-27,29,37-40,42H,8-16H2,1-7H3 |
| InChIKey | SQOTWNXPLYHYQJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.82 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|