C19H37N3O5 — CID 78156038
1-cyclohexyl-1-[6-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea (PubChem CID 78156038) has the molecular formula C19H37N3O5 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-cyclohexyl-1-[6-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea.
| Compound Name | 1-cyclohexyl-1-[6-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea |
|---|---|
| PubChem CID | 78156038 |
| Molecular Formula | C19H37N3O5 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | 1-cyclohexyl-1-[6-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea |
| SMILES | NC(=O)N(CCCCCCN1CC(O)C(O)C(O)C1CO)C1CCCCC1 |
| InChI | InChI=1S/C19H37N3O5/c20-19(27)22(14-8-4-3-5-9-14)11-7-2-1-6-10-21-12-16(24)18(26)17(25)15(21)13-23/h14-18,23-26H,1-13H2,(H2,20,27) |
| InChIKey | PTRHEDBKMKYEAR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|