C23H45N3O5 — CID 78156095
3-tert-butyl-1-cyclohexyl-1-[6-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea (PubChem CID 78156095) has the molecular formula C23H45N3O5 and a molecular weight of 443.63 g/mol. Its IUPAC name is 3-tert-butyl-1-cyclohexyl-1-[6-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea.
| Compound Name | 3-tert-butyl-1-cyclohexyl-1-[6-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea |
|---|---|
| PubChem CID | 78156095 |
| Molecular Formula | C23H45N3O5 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.34 |
| IUPAC Name | 3-tert-butyl-1-cyclohexyl-1-[6-[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea |
| SMILES | CC(C)(C)NC(=O)N(CCCCCCN1CC(O)C(O)C(O)C1CO)C1CCCCC1 |
| InChI | InChI=1S/C23H45N3O5/c1-23(2,3)24-22(31)26(17-11-7-6-8-12-17)14-10-5-4-9-13-25-15-19(28)21(30)20(29)18(25)16-27/h17-21,27-30H,4-16H2,1-3H3,(H,24,31) |
| InChIKey | GFBNIASMQRMEDU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|