About 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione
4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione (PubChem CID 78158612) has the molecular formula C17H13NO3
and a molecular weight of 279.30 g/mol. Its IUPAC name is 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione.
Molecular Properties
| Compound Name | 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione |
| PubChem CID | 78158612 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione |
| SMILES | O=C1OC2(C(=O)NCC2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C17H13NO3/c19-15-12-8-4-5-9-13(12)17(21-15)14(10-18-16(17)20)11-6-2-1-3-7-11/h1-9,14H,10H2,(H,18,20) |
| InChIKey | RCEPHOGOELZSFQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione?
The IUPAC name of 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione (CID 78158612) is 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione.
What is the SMILES notation for 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione?
The canonical SMILES for 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione is O=C1OC2(C(=O)NCC2c2ccccc2)c2ccccc21.
What is the InChIKey of 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione?
The InChIKey is RCEPHOGOELZSFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3/c19-15-12-8-4-5-9-13(12)17(21-15)14(10-18-16(17)20)11-6-2-1-3-7-11/h1-9,14H,10H2,(H,18,20).
What are the key properties of 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione?
4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione has a molecular weight of 279.30 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-phenylspiro[2-benzofuran-3,3'-pyrrolidine]-1,2'-dione is sourced from PubChem (CID 78158612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).