C19H16N4O2S — CID 7815925
N-(cyanomethyl)-2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-phenylacetamide (PubChem CID 7815925) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | N-(cyanomethyl)-2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 7815925 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-(cyanomethyl)-2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-phenylacetamide |
| SMILES | Cc1ccc(-c2nnc(SCC(=O)N(CC#N)c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C19H16N4O2S/c1-14-7-9-15(10-8-14)18-21-22-19(25-18)26-13-17(24)23(12-11-20)16-5-3-2-4-6-16/h2-10H,12-13H2,1H3 |
| InChIKey | QMRWUIRYQJMXGS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|