C11H19N3O7S — CID 78159505
[2-[(2-methylpropan-2-yl)oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 78159505) has the molecular formula C11H19N3O7S and a molecular weight of 337.35 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 78159505 |
| Molecular Formula | C11H19N3O7S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC(C)(C)ONC(=O)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C11H19N3O7S/c1-11(2,3)20-12-9(15)8-5-4-7-6-13(8)10(16)14(7)21-22(17,18)19/h7-8H,4-6H2,1-3H3,(H,12,15)(H,17,18,19) |
| InChIKey | DWOFTKGRBXANCE-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|