C20H17NO2 — CID 781607
(3R)-3-(2-methoxyphenyl)-3,4-dihydro-2H-benzo[f]quinolin-1-one (PubChem CID 781607) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is (3R)-3-(2-methoxyphenyl)-3,4-dihydro-2H-benzo[f]quinolin-1-one.
| Compound Name | (3R)-3-(2-methoxyphenyl)-3,4-dihydro-2H-benzo[f]quinolin-1-one |
|---|---|
| PubChem CID | 781607 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (3R)-3-(2-methoxyphenyl)-3,4-dihydro-2H-benzo[f]quinolin-1-one |
| SMILES | COc1ccccc1[C@H]1CC(=O)c2c(ccc3ccccc23)N1 |
| InChI | InChI=1S/C20H17NO2/c1-23-19-9-5-4-8-15(19)17-12-18(22)20-14-7-3-2-6-13(14)10-11-16(20)21-17/h2-11,17,21H,12H2,1H3/t17-/m1/s1 |
| InChIKey | UATAMXVFHRCWHJ-QGZVFWFLSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |