C16H21ClN2O3 — CID 7816268
(2R)-2-(4-chlorophenoxy)-N-(cyclohexylcarbamoyl)propanamide (PubChem CID 7816268) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenoxy)-N-(cyclohexylcarbamoyl)propanamide.
| Compound Name | (2R)-2-(4-chlorophenoxy)-N-(cyclohexylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 7816268 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (2R)-2-(4-chlorophenoxy)-N-(cyclohexylcarbamoyl)propanamide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H21ClN2O3/c1-11(22-14-9-7-12(17)8-10-14)15(20)19-16(21)18-13-5-3-2-4-6-13/h7-11,13H,2-6H2,1H3,(H2,18,19,20,21)/t11-/m1/s1 |
| InChIKey | GQFMGQALDGVYME-LLVKDONJSA-N |
| XLogP | 3.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |