C22H32BNO5 — CID 78164532
[10-(dimethylamino)-15,16-dihydroxy-2,6,6-trimethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid (PubChem CID 78164532) has the molecular formula C22H32BNO5 and a molecular weight of 401.31 g/mol. Its IUPAC name is [10-(dimethylamino)-15,16-dihydroxy-2,6,6-trimethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid.
| Compound Name | [10-(dimethylamino)-15,16-dihydroxy-2,6,6-trimethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid |
|---|---|
| PubChem CID | 78164532 |
| Molecular Formula | C22H32BNO5 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | [10-(dimethylamino)-15,16-dihydroxy-2,6,6-trimethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid |
| SMILES | CN(C)C1CCC2C(C)(C)CCCC2(C)c2c1oc1c(B(O)O)c(O)c(O)cc21 |
| InChI | InChI=1S/C22H32BNO5/c1-21(2)9-6-10-22(3)15(21)8-7-13(24(4)5)20-16(22)12-11-14(25)18(26)17(23(27)28)19(12)29-20/h11,13,15,25-28H,6-10H2,1-5H3 |
| InChIKey | RTEFHGRGCDTMHT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|