C16H15ClN2O4S — CID 7816512
(2S)-2-(4-chlorophenyl)sulfanyl-N-(2-methoxy-4-nitrophenyl)propanamide (PubChem CID 7816512) has the molecular formula C16H15ClN2O4S and a molecular weight of 366.83 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)sulfanyl-N-(2-methoxy-4-nitrophenyl)propanamide.
| Compound Name | (2S)-2-(4-chlorophenyl)sulfanyl-N-(2-methoxy-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 7816512 |
| Molecular Formula | C16H15ClN2O4S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)sulfanyl-N-(2-methoxy-4-nitrophenyl)propanamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@H](C)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN2O4S/c1-10(24-13-6-3-11(17)4-7-13)16(20)18-14-8-5-12(19(21)22)9-15(14)23-2/h3-10H,1-2H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | NRIZBONMBJNXJI-JTQLQIEISA-N |
| XLogP | 4.38 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|