C11H13F3N2O6S — CID 78167391
2,2,2-trifluoro-1-[2-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]ethanone (PubChem CID 78167391) has the molecular formula C11H13F3N2O6S and a molecular weight of 358.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 78167391 |
| Molecular Formula | C11H13F3N2O6S |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]ethanone |
| SMILES | O=C(c1cnc(NC2OC(CO)C(O)C(O)C2O)s1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O6S/c12-11(13,14)8(21)4-1-15-10(23-4)16-9-7(20)6(19)5(18)3(2-17)22-9/h1,3,5-7,9,17-20H,2H2,(H,15,16) |
| InChIKey | WXRSQRKVEOFTBW-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |