About 2,6-diethylpiperidine-3,4,5-triol
2,6-diethylpiperidine-3,4,5-triol (PubChem CID 78168139) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is 2,6-diethylpiperidine-3,4,5-triol.
Molecular Properties
| Compound Name | 2,6-diethylpiperidine-3,4,5-triol |
| PubChem CID | 78168139 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 2,6-diethylpiperidine-3,4,5-triol |
| SMILES | CCC1NC(CC)C(O)C(O)C1O |
| InChI | InChI=1S/C9H19NO3/c1-3-5-7(11)9(13)8(12)6(4-2)10-5/h5-13H,3-4H2,1-2H3 |
| InChIKey | OLSJFEJSUNZHMA-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-diethylpiperidine-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diethylpiperidine-3,4,5-triol?
The IUPAC name of 2,6-diethylpiperidine-3,4,5-triol (CID 78168139) is 2,6-diethylpiperidine-3,4,5-triol.
What is the SMILES notation for 2,6-diethylpiperidine-3,4,5-triol?
The canonical SMILES for 2,6-diethylpiperidine-3,4,5-triol is CCC1NC(CC)C(O)C(O)C1O.
What is the InChIKey of 2,6-diethylpiperidine-3,4,5-triol?
The InChIKey is OLSJFEJSUNZHMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3/c1-3-5-7(11)9(13)8(12)6(4-2)10-5/h5-13H,3-4H2,1-2H3.
What are the key properties of 2,6-diethylpiperidine-3,4,5-triol?
2,6-diethylpiperidine-3,4,5-triol has a molecular weight of 189.25 g/mol, XLogP of -0.77, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diethylpiperidine-3,4,5-triol is sourced from PubChem (CID 78168139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).