C11H18N5O3+ — CID 78168849
2-amino-2-methylpropan-1-ol;1,3-dimethylpurin-3-ium-2,6-dione (PubChem CID 78168849) has the molecular formula C11H18N5O3+ and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-amino-2-methylpropan-1-ol;1,3-dimethylpurin-3-ium-2,6-dione.
| Compound Name | 2-amino-2-methylpropan-1-ol;1,3-dimethylpurin-3-ium-2,6-dione |
|---|---|
| PubChem CID | 78168849 |
| Molecular Formula | C11H18N5O3+ |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-amino-2-methylpropan-1-ol;1,3-dimethylpurin-3-ium-2,6-dione |
| SMILES | CC(C)(N)CO.CN1C(=O)C2=NC=NC2=[N+](C)C1=O |
| InChI | InChI=1S/C7H7N4O2.C4H11NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-4(2,5)3-6/h3H,1-2H3;6H,3,5H2,1-2H3/q+1; |
| InChIKey | FSHUFUJGJZEOJT-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|