C6H8N4O3 — CID 78169896
1,4a,5,6,8,8a-hexahydropteridine-2,4,7-trione (PubChem CID 78169896) has the molecular formula C6H8N4O3 and a molecular weight of 184.15 g/mol. Its IUPAC name is 1,4a,5,6,8,8a-hexahydropteridine-2,4,7-trione.
| Compound Name | 1,4a,5,6,8,8a-hexahydropteridine-2,4,7-trione |
|---|---|
| PubChem CID | 78169896 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 1,4a,5,6,8,8a-hexahydropteridine-2,4,7-trione |
| SMILES | O=C1CNC2C(=O)NC(=O)NC2N1 |
| InChI | InChI=1S/C6H8N4O3/c11-2-1-7-3-4(8-2)9-6(13)10-5(3)12/h3-4,7H,1H2,(H,8,11)(H2,9,10,12,13) |
| InChIKey | XZWRYCPOKJGAEJ-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |