About 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione
5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione (PubChem CID 78171015) has the molecular formula C7H9FN2O2
and a molecular weight of 172.16 g/mol. Its IUPAC name is 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione |
| PubChem CID | 78171015 |
| Molecular Formula | C7H9FN2O2 |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione |
| SMILES | C=CCN1CC(F)C(=O)NC1=O |
| InChI | InChI=1S/C7H9FN2O2/c1-2-3-10-4-5(8)6(11)9-7(10)12/h2,5H,1,3-4H2,(H,9,11,12) |
| InChIKey | RCXILYNCXRHAHU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione?
The IUPAC name of 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione (CID 78171015) is 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione.
What is the SMILES notation for 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione?
The canonical SMILES for 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione is C=CCN1CC(F)C(=O)NC1=O.
What is the InChIKey of 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione?
The InChIKey is RCXILYNCXRHAHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN2O2/c1-2-3-10-4-5(8)6(11)9-7(10)12/h2,5H,1,3-4H2,(H,9,11,12).
What are the key properties of 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione?
5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione has a molecular weight of 172.16 g/mol, XLogP of 0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-prop-2-enyl-1,3-diazinane-2,4-dione is sourced from PubChem (CID 78171015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).