C15H22O4 — CID 78171494
4,12-dihydroxy-5-methyl-8-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,5]dodecan-11-one (PubChem CID 78171494) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4,12-dihydroxy-5-methyl-8-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,5]dodecan-11-one.
| Compound Name | 4,12-dihydroxy-5-methyl-8-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,5]dodecan-11-one |
|---|---|
| PubChem CID | 78171494 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4,12-dihydroxy-5-methyl-8-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,5]dodecan-11-one |
| SMILES | C=C(C)C1CCC2(C)C(O)CCC23C(=O)OC1C3O |
| InChI | InChI=1S/C15H22O4/c1-8(2)9-4-6-14(3)10(16)5-7-15(14)12(17)11(9)19-13(15)18/h9-12,16-17H,1,4-7H2,2-3H3 |
| InChIKey | ZWKJYFGQYZANRE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|