About 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde
5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde (PubChem CID 78172085) has the molecular formula C5H5FN2O3
and a molecular weight of 160.10 g/mol. Its IUPAC name is 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde |
| PubChem CID | 78172085 |
| Molecular Formula | C5H5FN2O3 |
| Molecular Weight | 160.10 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde |
| SMILES | O=CC1NC(=O)NC(=O)C1F |
| InChI | InChI=1S/C5H5FN2O3/c6-3-2(1-9)7-5(11)8-4(3)10/h1-3H,(H2,7,8,10,11) |
| InChIKey | BHJRXJOZBXKCIM-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.10 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde?
The IUPAC name of 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde (CID 78172085) is 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde.
What is the SMILES notation for 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde?
The canonical SMILES for 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde is O=CC1NC(=O)NC(=O)C1F.
What is the InChIKey of 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde?
The InChIKey is BHJRXJOZBXKCIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5FN2O3/c6-3-2(1-9)7-5(11)8-4(3)10/h1-3H,(H2,7,8,10,11).
What are the key properties of 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde?
5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde has a molecular weight of 160.10 g/mol, XLogP of -1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,6-dioxo-1,3-diazinane-4-carbaldehyde is sourced from PubChem (CID 78172085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).