About 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene
8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene (PubChem CID 78173837) has the molecular formula C13H20N2S
and a molecular weight of 236.38 g/mol. Its IUPAC name is 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene.
Molecular Properties
| Compound Name | 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene |
| PubChem CID | 78173837 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene |
| SMILES | C1=NC2CCCC3SC4CCCCC4N1C23 |
| InChI | InChI=1S/C13H20N2S/c1-2-6-11-10(5-1)15-8-14-9-4-3-7-12(16-11)13(9)15/h8-13H,1-7H2 |
| InChIKey | JGQGWXUQPKFKGJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene?
The IUPAC name of 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene (CID 78173837) is 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene.
What is the SMILES notation for 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene?
The canonical SMILES for 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene is C1=NC2CCCC3SC4CCCCC4N1C23.
What is the InChIKey of 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene?
The InChIKey is JGQGWXUQPKFKGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2S/c1-2-6-11-10(5-1)15-8-14-9-4-3-7-12(16-11)13(9)15/h8-13H,1-7H2.
What are the key properties of 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene?
8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene has a molecular weight of 236.38 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadec-14-ene is sourced from PubChem (CID 78173837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).