About 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate
2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate (PubChem CID 78174347) has the molecular formula C10H12N5O2S+
and a molecular weight of 266.31 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate.
Molecular Properties
| Compound Name | 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate |
| PubChem CID | 78174347 |
| Molecular Formula | C10H12N5O2S+ |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CCSC#N)N(C)C1=O |
| InChI | InChI=1S/C10H12N5O2S/c1-13-8-7(9(16)14(2)10(13)17)15(6-12-8)3-4-18-5-11/h6-7H,3-4H2,1-2H3/q+1 |
| InChIKey | ZXWAAQCIDHGGCZ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 79.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate?
The IUPAC name of 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate (CID 78174347) is 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate.
What is the SMILES notation for 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate?
The canonical SMILES for 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate is CN1C(=O)C2C(=NC=[N+]2CCSC#N)N(C)C1=O.
What is the InChIKey of 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate?
The InChIKey is ZXWAAQCIDHGGCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N5O2S/c1-13-8-7(9(16)14(2)10(13)17)15(6-12-8)3-4-18-5-11/h6-7H,3-4H2,1-2H3/q+1.
What are the key properties of 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate?
2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate has a molecular weight of 266.31 g/mol, XLogP of -0.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)ethyl thiocyanate is sourced from PubChem (CID 78174347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).