About 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile
1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile (PubChem CID 78176083) has the molecular formula C9H10N5O2+
and a molecular weight of 220.21 g/mol. Its IUPAC name is 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile.
Molecular Properties
| Compound Name | 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile |
| PubChem CID | 78176083 |
| Molecular Formula | C9H10N5O2+ |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile |
| SMILES | CN1C(=O)C2C(=NC(C#N)=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C9H10N5O2/c1-12-5(4-10)11-7-6(12)8(15)14(3)9(16)13(7)2/h6H,1-3H3/q+1 |
| InChIKey | PPMPBXPSZGHMQA-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 79.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile?
The IUPAC name of 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile (CID 78176083) is 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile.
What is the SMILES notation for 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile?
The canonical SMILES for 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile is CN1C(=O)C2C(=NC(C#N)=[N+]2C)N(C)C1=O.
What is the InChIKey of 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile?
The InChIKey is PPMPBXPSZGHMQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N5O2/c1-12-5(4-10)11-7-6(12)8(15)14(3)9(16)13(7)2/h6H,1-3H3/q+1.
What are the key properties of 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile?
1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile has a molecular weight of 220.21 g/mol, XLogP of -1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-carbonitrile is sourced from PubChem (CID 78176083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).