C24H27NO9 — CID 78178149
3-hydroxy-6-(4-hydroxy-17-methyl-2,9,13-trioxo-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraen-7-yl)-N,N,2-trimethyloxan-4-amine oxide (PubChem CID 78178149) has the molecular formula C24H27NO9 and a molecular weight of 473.48 g/mol. Its IUPAC name is 3-hydroxy-6-(4-hydroxy-17-methyl-2,9,13-trioxo-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraen-7-yl)-N,N,2-trimethyloxan-4-amine oxide.
| Compound Name | 3-hydroxy-6-(4-hydroxy-17-methyl-2,9,13-trioxo-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraen-7-yl)-N,N,2-trimethyloxan-4-amine oxide |
|---|---|
| PubChem CID | 78178149 |
| Molecular Formula | C24H27NO9 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 3-hydroxy-6-(4-hydroxy-17-methyl-2,9,13-trioxo-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraen-7-yl)-N,N,2-trimethyloxan-4-amine oxide |
| SMILES | CC1OC2CC(=O)OC2C2=C1C(=O)c1c(O)ccc(C3CC([N+](C)(C)[O-])C(O)C(C)O3)c1C2=O |
| InChI | InChI=1S/C24H27NO9/c1-9-17-20(24-15(32-9)8-16(27)34-24)23(30)18-11(5-6-13(26)19(18)22(17)29)14-7-12(25(3,4)31)21(28)10(2)33-14/h5-6,9-10,12,14-15,21,24,26,28H,7-8H2,1-4H3 |
| InChIKey | AFVFOGCWMMKRCH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|