C10H4F6N2O — CID 78180206
3,7-bis(trifluoromethyl)-4aH-quinoxalin-2-one (PubChem CID 78180206) has the molecular formula C10H4F6N2O and a molecular weight of 282.14 g/mol. Its IUPAC name is 3,7-bis(trifluoromethyl)-4aH-quinoxalin-2-one.
| Compound Name | 3,7-bis(trifluoromethyl)-4aH-quinoxalin-2-one |
|---|---|
| PubChem CID | 78180206 |
| Molecular Formula | C10H4F6N2O |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 3,7-bis(trifluoromethyl)-4aH-quinoxalin-2-one |
| SMILES | O=C1N=C2C=C(C(F)(F)F)C=CC2N=C1C(F)(F)F |
| InChI | InChI=1S/C10H4F6N2O/c11-9(12,13)4-1-2-5-6(3-4)18-8(19)7(17-5)10(14,15)16/h1-3,5H |
| InChIKey | PHKRAIBDKUGVGI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |