C29H20O8 — CID 78182646
4',6,6'-trihydroxy-2'-(3-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)ethenyl]spiro[1-benzofuran-3,3'-2H-1-benzofuran]-2-one (PubChem CID 78182646) has the molecular formula C29H20O8 and a molecular weight of 496.47 g/mol. Its IUPAC name is 4',6,6'-trihydroxy-2'-(3-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)ethenyl]spiro[1-benzofuran-3,3'-2H-1-benzofuran]-2-one.
| Compound Name | 4',6,6'-trihydroxy-2'-(3-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)ethenyl]spiro[1-benzofuran-3,3'-2H-1-benzofuran]-2-one |
|---|---|
| PubChem CID | 78182646 |
| Molecular Formula | C29H20O8 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 4',6,6'-trihydroxy-2'-(3-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)ethenyl]spiro[1-benzofuran-3,3'-2H-1-benzofuran]-2-one |
| SMILES | O=C1Oc2cc(O)cc(C=Cc3ccc(O)cc3)c2C12c1c(O)cc(O)cc1OC2c1cccc(O)c1 |
| InChI | InChI=1S/C29H20O8/c30-18-8-5-15(6-9-18)4-7-16-10-20(32)13-23-25(16)29(28(35)37-23)26-22(34)12-21(33)14-24(26)36-27(29)17-2-1-3-19(31)11-17/h1-14,27,30-34H |
| InChIKey | KGEBEOHZPNIDOO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|