C7H11ClN2O2 — CID 78201033
6-chloro-3-propyl-1,3-diazinane-2,4-dione (PubChem CID 78201033) has the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. Its IUPAC name is 6-chloro-3-propyl-1,3-diazinane-2,4-dione.
| Compound Name | 6-chloro-3-propyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 78201033 |
| Molecular Formula | C7H11ClN2O2 |
| Molecular Weight | 190.63 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 6-chloro-3-propyl-1,3-diazinane-2,4-dione |
| SMILES | CCCN1C(=O)CC(Cl)NC1=O |
| InChI | InChI=1S/C7H11ClN2O2/c1-2-3-10-6(11)4-5(8)9-7(10)12/h5H,2-4H2,1H3,(H,9,12) |
| InChIKey | ZKRBUQOTVBDHEM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.63 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|