About 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide
2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide (PubChem CID 78202175) has the molecular formula C11H16N5O3S+
and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide.
Molecular Properties
| Compound Name | 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide |
| PubChem CID | 78202175 |
| Molecular Formula | C11H16N5O3S+ |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide |
| SMILES | CC[N+]1=C(SCC(N)=O)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C11H15N5O3S/c1-4-16-7-8(13-10(16)20-5-6(12)17)14(2)11(19)15(3)9(7)18/h7H,4-5H2,1-3H3,(H-,12,17)/p+1 |
| InChIKey | OAWDRIBDTPMKIV-UHFFFAOYSA-O |
| XLogP | -1.10 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide?
The IUPAC name of 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide (CID 78202175) is 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide.
What is the SMILES notation for 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide?
The canonical SMILES for 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide is CC[N+]1=C(SCC(N)=O)N=C2C1C(=O)N(C)C(=O)N2C.
What is the InChIKey of 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide?
The InChIKey is OAWDRIBDTPMKIV-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H15N5O3S/c1-4-16-7-8(13-10(16)20-5-6(12)17)14(2)11(19)15(3)9(7)18/h7H,4-5H2,1-3H3,(H-,12,17)/p+1.
What are the key properties of 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide?
2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide has a molecular weight of 298.35 g/mol, XLogP of -1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-ethyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetamide is sourced from PubChem (CID 78202175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).