C10H13N4O4S+ — CID 78204381
2-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetic acid (PubChem CID 78204381) has the molecular formula C10H13N4O4S+ and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetic acid.
| Compound Name | 2-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 78204381 |
| Molecular Formula | C10H13N4O4S+ |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetic acid |
| SMILES | CN1C(=O)C2C(=NC(SCC(=O)O)=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C10H12N4O4S/c1-12-6-7(11-9(12)19-4-5(15)16)13(2)10(18)14(3)8(6)17/h6H,4H2,1-3H3/p+1 |
| InChIKey | PKCLMLGXQYQTRM-UHFFFAOYSA-O |
| XLogP | -0.89 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|