About 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde
4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde (PubChem CID 782045) has the molecular formula C14H19BrN2O3
and a molecular weight of 343.22 g/mol. Its IUPAC name is 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde |
| PubChem CID | 782045 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde |
| SMILES | COc1cc(Br)c(CN2CCN(C=O)CC2)cc1OC |
| InChI | InChI=1S/C14H19BrN2O3/c1-19-13-7-11(12(15)8-14(13)20-2)9-16-3-5-17(10-18)6-4-16/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | IUVYDSDSJPKUMC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde?
The IUPAC name of 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde (CID 782045) is 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde.
What is the SMILES notation for 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde?
The canonical SMILES for 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde is COc1cc(Br)c(CN2CCN(C=O)CC2)cc1OC.
What is the InChIKey of 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde?
The InChIKey is IUVYDSDSJPKUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrN2O3/c1-19-13-7-11(12(15)8-14(13)20-2)9-16-3-5-17(10-18)6-4-16/h7-8,10H,3-6,9H2,1-2H3.
What are the key properties of 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde?
4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde has a molecular weight of 343.22 g/mol, XLogP of 1.74, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-bromo-4,5-dimethoxyphenyl)methyl]piperazine-1-carbaldehyde is sourced from PubChem (CID 782045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).