C17H20O3 — CID 78204785
7-ethoxy-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 78204785) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 7-ethoxy-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 7-ethoxy-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 78204785 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 7-ethoxy-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | CCOC1CCC2C(=O)C(c3ccccc3)=COC2C1 |
| InChI | InChI=1S/C17H20O3/c1-2-19-13-8-9-14-16(10-13)20-11-15(17(14)18)12-6-4-3-5-7-12/h3-7,11,13-14,16H,2,8-10H2,1H3 |
| InChIKey | IOYMLCPFPQDLOT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |