About 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one
6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one (PubChem CID 78205838) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one |
| PubChem CID | 78205838 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one |
| SMILES | C=CCC1C(=O)NC(c2ccccc2)NC1C |
| InChI | InChI=1S/C14H18N2O/c1-3-7-12-10(2)15-13(16-14(12)17)11-8-5-4-6-9-11/h3-6,8-10,12-13,15H,1,7H2,2H3,(H,16,17) |
| InChIKey | GPQNZOPFRIODPI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one?
The IUPAC name of 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one (CID 78205838) is 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one.
What is the SMILES notation for 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one?
The canonical SMILES for 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one is C=CCC1C(=O)NC(c2ccccc2)NC1C.
What is the InChIKey of 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one?
The InChIKey is GPQNZOPFRIODPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c1-3-7-12-10(2)15-13(16-14(12)17)11-8-5-4-6-9-11/h3-6,8-10,12-13,15H,1,7H2,2H3,(H,16,17).
What are the key properties of 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one?
6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one has a molecular weight of 230.31 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-phenyl-5-prop-2-enyl-1,3-diazinan-4-one is sourced from PubChem (CID 78205838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).