C12H22N6O4 — CID 78206632
8-hydrazinyl-7-(2-hydroxy-3-propan-2-yloxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 78206632) has the molecular formula C12H22N6O4 and a molecular weight of 314.35 g/mol. Its IUPAC name is 8-hydrazinyl-7-(2-hydroxy-3-propan-2-yloxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-hydrazinyl-7-(2-hydroxy-3-propan-2-yloxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78206632 |
| Molecular Formula | C12H22N6O4 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 8-hydrazinyl-7-(2-hydroxy-3-propan-2-yloxypropyl)-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CC(C)OCC(O)CN1C(NN)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C12H22N6O4/c1-6(2)22-5-7(19)4-18-8-9(14-11(18)16-13)17(3)12(21)15-10(8)20/h6-9,19H,4-5,13H2,1-3H3,(H,14,16)(H,15,20,21) |
| InChIKey | XBKPJZLTUVUEPB-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|