C12H16O2 — CID 78207990
2,3,4a,5,6,7,8,8a-octahydro-1H-cyclopenta[b]chromen-9-one (PubChem CID 78207990) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydro-1H-cyclopenta[b]chromen-9-one.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydro-1H-cyclopenta[b]chromen-9-one |
|---|---|
| PubChem CID | 78207990 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydro-1H-cyclopenta[b]chromen-9-one |
| SMILES | O=C1C2=C(CCC2)OC2CCCCC12 |
| InChI | InChI=1S/C12H16O2/c13-12-8-4-1-2-6-10(8)14-11-7-3-5-9(11)12/h8,10H,1-7H2 |
| InChIKey | BXSMGCCVNWQYBJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |