C13H19N4O4S+ — CID 78208579
propan-2-yl 2-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetate (PubChem CID 78208579) has the molecular formula C13H19N4O4S+ and a molecular weight of 327.39 g/mol. Its IUPAC name is propan-2-yl 2-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetate.
| Compound Name | propan-2-yl 2-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 78208579 |
| Molecular Formula | C13H19N4O4S+ |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | propan-2-yl 2-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]acetate |
| SMILES | CC(C)OC(=O)CSC1=[N+](C)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C13H19N4O4S/c1-7(2)21-8(18)6-22-12-14-10-9(15(12)3)11(19)17(5)13(20)16(10)4/h7,9H,6H2,1-5H3/q+1 |
| InChIKey | IQRQUAOHSJXRER-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|