About 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione
7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione (PubChem CID 78209605) has the molecular formula C14H24N5O4+
and a molecular weight of 326.38 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione.
Molecular Properties
| Compound Name | 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione |
| PubChem CID | 78209605 |
| Molecular Formula | C14H24N5O4+ |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione |
| SMILES | CN(C)CCCN1C(=O)C2C(=[N+]=CN2CC(O)CO)N(C)C1=O |
| InChI | InChI=1S/C14H24N5O4/c1-16(2)5-4-6-19-13(22)11-12(17(3)14(19)23)15-9-18(11)7-10(21)8-20/h9-11,20-21H,4-8H2,1-3H3/q+1 |
| InChIKey | SJCIIPGYHHWTKD-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione?
The IUPAC name of 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione (CID 78209605) is 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione.
What is the SMILES notation for 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione?
The canonical SMILES for 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione is CN(C)CCCN1C(=O)C2C(=[N+]=CN2CC(O)CO)N(C)C1=O.
What is the InChIKey of 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione?
The InChIKey is SJCIIPGYHHWTKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N5O4/c1-16(2)5-4-6-19-13(22)11-12(17(3)14(19)23)15-9-18(11)7-10(21)8-20/h9-11,20-21H,4-8H2,1-3H3/q+1.
What are the key properties of 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione?
7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione has a molecular weight of 326.38 g/mol, XLogP of -2.64, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,3-dihydroxypropyl)-1-[3-(dimethylamino)propyl]-3-methyl-5H-purin-9-ium-2,6-dione is sourced from PubChem (CID 78209605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).