C80H109F2N13O12S2Ti — CID 78210004
CID 78210004 (PubChem CID 78210004) has the molecular formula C80H109F2N13O12S2Ti and a molecular weight of 1594.83 g/mol.
| Compound Name | CID 78210004 |
|---|---|
| PubChem CID | 78210004 |
| Molecular Formula | C80H109F2N13O12S2Ti |
| Molecular Weight | 1594.83 g/mol |
| Exact Mass | 1593.72 |
| IUPAC Name | — |
| SMILES | C[C@@H](O)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](NC(=O)[C@H](Cc2ccccc2)NC(=O)Cn2nnc3c2CCCCCC3OCCCCCC[C]2[CH][CH][CH][CH]2)CSSC[C@@H](C(=O)N[C@H](CO)[C@@H](C)O)NC1=O.C[C]1[C](C)[C](C)[C](C)[C]1C.F[Ti]F |
| InChI | InChI=1S/C70H94N13O12S2.C10H15.2FH.Ti/c1-44(85)56(41-84)77-69(93)58-43-97-96-42-57(78-65(89)53(36-47-25-9-5-10-26-47)73-61(87)40-83-59-32-13-7-14-33-60(63(59)81-82-83)95-35-21-4-3-8-22-46-23-15-16-24-46)68(92)75-54(37-48-27-11-6-12-28-48)66(90)76-55(38-49-39-72-51-30-18-17-29-50(49)51)67(91)74-52(31-19-20-34-71)64(88)80-62(45(2)86)70(94)79-58;1-6-7(2)9(4)10(5)8(6)3;;;/h5-6,9-12,15-18,23-30,39,44-45,52-58,60,62,72,84-86H,3-4,7-8,13-14,19-22,31-38,40-43,71H2,1-2H3,(H,73,87)(H,74,91)(H,75,92)(H,76,90)(H,77,93)(H,78,89)(H,79,94)(H,80,88);1-5H3;2*1H;/q;;;;+2/p-2/t44-,45-,52+,53+,54+,55-,56-,57+,58+,60?,62+;;;;/m1..../s1 |
| InChIKey | FAIOXVQFBTVXQX-WGJHGSHHSA-L |
| XLogP | 6.98 |
| TPSA | 375.24 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 110 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1594.83 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|