C26H31FO3 — CID 78210072
[(3S,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-fluorobenzoate (PubChem CID 78210072) has the molecular formula C26H31FO3 and a molecular weight of 410.53 g/mol. Its IUPAC name is [(3S,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-fluorobenzoate.
| Compound Name | [(3S,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 78210072 |
| Molecular Formula | C26H31FO3 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [(3S,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-fluorobenzoate |
| SMILES | C[C@]12CC[C@H](OC(=O)c3ccc(F)cc3)CC1=CCC1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C26H31FO3/c1-25-13-11-19(30-24(29)16-3-6-18(27)7-4-16)15-17(25)5-8-20-21-9-10-23(28)26(21,2)14-12-22(20)25/h3-7,19-22H,8-15H2,1-2H3/t19-,20?,21?,22?,25-,26-/m0/s1 |
| InChIKey | IUSJWDXQDRIDEQ-ULLPPOAPSA-N |
| XLogP | 5.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|