C15H23N5O2 — CID 78210913
3-methyl-8-(4-methylpiperidin-1-yl)-7-prop-2-enyl-4,5-dihydropurine-2,6-dione (PubChem CID 78210913) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-methyl-8-(4-methylpiperidin-1-yl)-7-prop-2-enyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3-methyl-8-(4-methylpiperidin-1-yl)-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78210913 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 3-methyl-8-(4-methylpiperidin-1-yl)-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCN1C(N2CCC(C)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C15H23N5O2/c1-4-7-20-11-12(18(3)15(22)17-13(11)21)16-14(20)19-8-5-10(2)6-9-19/h4,10-12H,1,5-9H2,2-3H3,(H,17,21,22) |
| InChIKey | CRJPQRUYJUNQNU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|