C22H24N4O — CID 78212452
6-amino-4-(4-phenylphenyl)-3-propyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 78212452) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 6-amino-4-(4-phenylphenyl)-3-propyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(4-phenylphenyl)-3-propyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 78212452 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 6-amino-4-(4-phenylphenyl)-3-propyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | CCCC1NNC2OC(N)=C(C#N)C(c3ccc(-c4ccccc4)cc3)C12 |
| InChI | InChI=1S/C22H24N4O/c1-2-6-18-20-19(17(13-23)21(24)27-22(20)26-25-18)16-11-9-15(10-12-16)14-7-4-3-5-8-14/h3-5,7-12,18-20,22,25-26H,2,6,24H2,1H3 |
| InChIKey | HGXWBKPTJBIAJY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |