About 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione
7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione (PubChem CID 78212528) has the molecular formula C15H24N5O3S+
and a molecular weight of 354.46 g/mol. Its IUPAC name is 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione.
Molecular Properties
| Compound Name | 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione |
| PubChem CID | 78212528 |
| Molecular Formula | C15H24N5O3S+ |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC[N+]1=C(SCCN2CCOCC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C15H24N5O3S/c1-4-20-11-12(17(2)15(22)18(3)13(11)21)16-14(20)24-10-7-19-5-8-23-9-6-19/h11H,4-10H2,1-3H3/q+1 |
| InChIKey | LIDNARCGMVKDCM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione?
The IUPAC name of 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione (CID 78212528) is 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione.
What is the SMILES notation for 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione?
The canonical SMILES for 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione is CC[N+]1=C(SCCN2CCOCC2)N=C2C1C(=O)N(C)C(=O)N2C.
What is the InChIKey of 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione?
The InChIKey is LIDNARCGMVKDCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N5O3S/c1-4-20-11-12(17(2)15(22)18(3)13(11)21)16-14(20)24-10-7-19-5-8-23-9-6-19/h11H,4-10H2,1-3H3/q+1.
What are the key properties of 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione?
7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione has a molecular weight of 354.46 g/mol, XLogP of -0.26, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-1,3-dimethyl-8-(2-morpholin-4-ylethylsulfanyl)-5H-purin-7-ium-2,6-dione is sourced from PubChem (CID 78212528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).