C19H26N6O2 — CID 78213209
3-methyl-7-(3-phenylpropyl)-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione (PubChem CID 78213209) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 3-methyl-7-(3-phenylpropyl)-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3-methyl-7-(3-phenylpropyl)-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78213209 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 3-methyl-7-(3-phenylpropyl)-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(N1CCNCC1)N2CCCc1ccccc1 |
| InChI | InChI=1S/C19H26N6O2/c1-23-16-15(17(26)22-19(23)27)25(11-5-8-14-6-3-2-4-7-14)18(21-16)24-12-9-20-10-13-24/h2-4,6-7,15-16,20H,5,8-13H2,1H3,(H,22,26,27) |
| InChIKey | NAGQSFHQAMVTCR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |