C20H24BrNO5 — CID 78213520
[3-(2-bromophenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-diethylcarbamate (PubChem CID 78213520) has the molecular formula C20H24BrNO5 and a molecular weight of 438.32 g/mol. Its IUPAC name is [3-(2-bromophenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-diethylcarbamate.
| Compound Name | [3-(2-bromophenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 78213520 |
| Molecular Formula | C20H24BrNO5 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | [3-(2-bromophenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC1CCC2C(=O)C(Oc3ccccc3Br)=COC2C1 |
| InChI | InChI=1S/C20H24BrNO5/c1-3-22(4-2)20(24)26-13-9-10-14-17(11-13)25-12-18(19(14)23)27-16-8-6-5-7-15(16)21/h5-8,12-14,17H,3-4,9-11H2,1-2H3 |
| InChIKey | NFMSSDWRBFGWRY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |