C14H20N4O6 — CID 7821812
[2-(ethylcarbamoylamino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 7821812) has the molecular formula C14H20N4O6 and a molecular weight of 340.34 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 7821812 |
| Molecular Formula | C14H20N4O6 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | CCNC(=O)NC(=O)COC(=O)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C14H20N4O6/c1-2-15-12(22)16-9(19)8-24-10(20)7-18-11(21)14(17-13(18)23)5-3-4-6-14/h2-8H2,1H3,(H,17,23)(H2,15,16,19,22) |
| InChIKey | UYPVQJDTDPZDRP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|