C22H30N2O4 — CID 7821999
(4-tert-butyl-2,6-dimethylphenyl)methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 7821999) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 7821999 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1COC(=O)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C22H30N2O4/c1-14-10-16(21(3,4)5)11-15(2)17(14)13-28-18(25)12-24-19(26)22(23-20(24)27)8-6-7-9-22/h10-11H,6-9,12-13H2,1-5H3,(H,23,27) |
| InChIKey | BCGFNYBIRGTFMT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|