C26H28O7 — CID 78221899
[3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dimethoxybenzoate (PubChem CID 78221899) has the molecular formula C26H28O7 and a molecular weight of 452.50 g/mol. Its IUPAC name is [3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dimethoxybenzoate.
| Compound Name | [3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 78221899 |
| Molecular Formula | C26H28O7 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [3-(3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OC2CCC3C(=O)C(Oc4cc(C)cc(C)c4)=COC3C2)cc1OC |
| InChI | InChI=1S/C26H28O7/c1-15-9-16(2)11-19(10-15)32-24-14-31-22-13-18(6-7-20(22)25(24)27)33-26(28)17-5-8-21(29-3)23(12-17)30-4/h5,8-12,14,18,20,22H,6-7,13H2,1-4H3 |
| InChIKey | BSTADHFRHPSBAA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |