C19H21ClO6 — CID 78222343
[3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] methyl carbonate (PubChem CID 78222343) has the molecular formula C19H21ClO6 and a molecular weight of 380.82 g/mol. Its IUPAC name is [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] methyl carbonate.
| Compound Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] methyl carbonate |
|---|---|
| PubChem CID | 78222343 |
| Molecular Formula | C19H21ClO6 |
| Molecular Weight | 380.82 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] methyl carbonate |
| SMILES | COC(=O)OC1CCC2C(=O)C(Oc3cc(C)c(Cl)c(C)c3)=COC2C1 |
| InChI | InChI=1S/C19H21ClO6/c1-10-6-13(7-11(2)17(10)20)25-16-9-24-15-8-12(26-19(22)23-3)4-5-14(15)18(16)21/h6-7,9,12,14-15H,4-5,8H2,1-3H3 |
| InChIKey | XVNHUNCVMPDQDS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |