C20H23ClO6 — CID 78222356
[3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] ethyl carbonate (PubChem CID 78222356) has the molecular formula C20H23ClO6 and a molecular weight of 394.85 g/mol. Its IUPAC name is [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] ethyl carbonate.
| Compound Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] ethyl carbonate |
|---|---|
| PubChem CID | 78222356 |
| Molecular Formula | C20H23ClO6 |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1CCC2C(=O)C(Oc3cc(C)c(Cl)c(C)c3)=COC2C1 |
| InChI | InChI=1S/C20H23ClO6/c1-4-24-20(23)27-13-5-6-15-16(9-13)25-10-17(19(15)22)26-14-7-11(2)18(21)12(3)8-14/h7-8,10,13,15-16H,4-6,9H2,1-3H3 |
| InChIKey | VFDDBBFWWSKRDO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |