C19H24O7 — CID 78225333
(4S,9S,10S,12E)-9,10-dihydroxy-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15-triene-2,8,18-trione (PubChem CID 78225333) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is (4S,9S,10S,12E)-9,10-dihydroxy-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15-triene-2,8,18-trione.
| Compound Name | (4S,9S,10S,12E)-9,10-dihydroxy-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15-triene-2,8,18-trione |
|---|---|
| PubChem CID | 78225333 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (4S,9S,10S,12E)-9,10-dihydroxy-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15-triene-2,8,18-trione |
| SMILES | COC1=CC2=C(C(=O)C1)C(=O)O[C@@H](C)CCCC(=O)[C@@H](O)[C@@H](O)C/C=C/2 |
| InChI | InChI=1S/C19H24O7/c1-11-5-3-7-14(20)18(23)15(21)8-4-6-12-9-13(25-2)10-16(22)17(12)19(24)26-11/h4,6,9,11,15,18,21,23H,3,5,7-8,10H2,1-2H3/b6-4+/t11-,15-,18+/m0/s1 |
| InChIKey | ANLCPQABGHSZDD-XZUJVHTDSA-N |
| XLogP | 1.14 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|