About [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium
[(6R)-6-carboxy-7-λ6-selanylheptyl]azanium (PubChem CID 78225450) has the molecular formula C8H22NO2Se+
and a molecular weight of 243.23 g/mol. Its IUPAC name is [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium.
Molecular Properties
| Compound Name | [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium |
| PubChem CID | 78225450 |
| Molecular Formula | C8H22NO2Se+ |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium |
| SMILES | [NH3+]CCCCC[C@@H](C[SeH5])C(=O)O |
| InChI | InChI=1S/C8H21NO2Se/c9-5-3-1-2-4-7(6-12)8(10)11/h7H,1-6,9H2,12H5,(H,10,11)/p+1/t7-/m0/s1 |
| InChIKey | SIYQNRXJAZIUMZ-ZETCQYMHSA-O |
| XLogP | -1.26 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium?
The IUPAC name of [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium (CID 78225450) is [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium.
What is the SMILES notation for [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium?
The canonical SMILES for [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium is [NH3+]CCCCC[C@@H](C[SeH5])C(=O)O.
What is the InChIKey of [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium?
The InChIKey is SIYQNRXJAZIUMZ-ZETCQYMHSA-O. The full InChI is InChI=1S/C8H21NO2Se/c9-5-3-1-2-4-7(6-12)8(10)11/h7H,1-6,9H2,12H5,(H,10,11)/p+1/t7-/m0/s1.
What are the key properties of [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium?
[(6R)-6-carboxy-7-λ6-selanylheptyl]azanium has a molecular weight of 243.23 g/mol, XLogP of -1.26, 7 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(6R)-6-carboxy-7-λ6-selanylheptyl]azanium is sourced from PubChem (CID 78225450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).