C29H29ClN7OS+ — CID 78225571
6-[2-chloro-4-(1,3-thiazol-5-yl)phenyl]-8-ethyl-2-[4-(4-methylpiperazin-4-ium-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 78225571) has the molecular formula C29H29ClN7OS+ and a molecular weight of 559.12 g/mol. Its IUPAC name is 6-[2-chloro-4-(1,3-thiazol-5-yl)phenyl]-8-ethyl-2-[4-(4-methylpiperazin-4-ium-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-[2-chloro-4-(1,3-thiazol-5-yl)phenyl]-8-ethyl-2-[4-(4-methylpiperazin-4-ium-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 78225571 |
| Molecular Formula | C29H29ClN7OS+ |
| Molecular Weight | 559.12 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 6-[2-chloro-4-(1,3-thiazol-5-yl)phenyl]-8-ethyl-2-[4-(4-methylpiperazin-4-ium-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2ccc(-c3cncs3)cc2Cl)cc2cnc(Nc3ccc(N4CC[NH+](C)CC4)cc3)nc21 |
| InChI | InChI=1S/C29H28ClN7OS/c1-3-37-27-20(14-24(28(37)38)23-9-4-19(15-25(23)30)26-17-31-18-39-26)16-32-29(34-27)33-21-5-7-22(8-6-21)36-12-10-35(2)11-13-36/h4-9,14-18H,3,10-13H2,1-2H3,(H,32,33,34)/p+1 |
| InChIKey | DHUJCQOUWQMVCG-UHFFFAOYSA-O |
| XLogP | 4.33 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.12 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|