About cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium
cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium (PubChem CID 78225627) has the molecular formula C8H20NO3S+
and a molecular weight of 210.32 g/mol. Its IUPAC name is cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium.
Molecular Properties
| Compound Name | cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium |
| PubChem CID | 78225627 |
| Molecular Formula | C8H20NO3S+ |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium |
| SMILES | OS(O)(O)CC[NH2+]C1CCCCC1 |
| InChI | InChI=1S/C8H19NO3S/c10-13(11,12)7-6-9-8-4-2-1-3-5-8/h8-12H,1-7H2/p+1 |
| InChIKey | HSLCLKRCAPXETR-UHFFFAOYSA-O |
| XLogP | 1.11 |
| TPSA | 77.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium?
The IUPAC name of cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium (CID 78225627) is cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium.
What is the SMILES notation for cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium?
The canonical SMILES for cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium is OS(O)(O)CC[NH2+]C1CCCCC1.
What is the InChIKey of cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium?
The InChIKey is HSLCLKRCAPXETR-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H19NO3S/c10-13(11,12)7-6-9-8-4-2-1-3-5-8/h8-12H,1-7H2/p+1.
What are the key properties of cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium?
cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium has a molecular weight of 210.32 g/mol, XLogP of 1.11, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[2-(trihydroxy-λ4-sulfanyl)ethyl]azanium is sourced from PubChem (CID 78225627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).