C12H24O6 — CID 78225729
(6R,7R)-6,7-bis(2-methoxyethoxy)-1,4-dioxocane (PubChem CID 78225729) has the molecular formula C12H24O6 and a molecular weight of 264.32 g/mol. Its IUPAC name is (6R,7R)-6,7-bis(2-methoxyethoxy)-1,4-dioxocane.
| Compound Name | (6R,7R)-6,7-bis(2-methoxyethoxy)-1,4-dioxocane |
|---|---|
| PubChem CID | 78225729 |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (6R,7R)-6,7-bis(2-methoxyethoxy)-1,4-dioxocane |
| SMILES | COCCO[C@@H]1COCCOC[C@H]1OCCOC |
| InChI | InChI=1S/C12H24O6/c1-13-3-7-17-11-9-15-5-6-16-10-12(11)18-8-4-14-2/h11-12H,3-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | TWCCITYCGPHWQR-VXGBXAGGSA-N |
| XLogP | 0.10 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|